4-Chloro-2-nitroaniline 13C6

[13C6]-4-Chloro-2-nitroaniline is a stable isotopic labeled compound, which is a derivative of 4-Chloro-2-nitroaniline, with six carbon-13 atoms in its molecular structure. It can be used as a stable isotope internal standard for the quantification of 4-Chloro-2-nitroaniline in environmental samples using techniques such as gas chromatography-mass spectrometry (GC-MS). This compound can serve as an analytical tool in environmental and toxicological studies to understand the fate and transport of 4-Chloro-2-nitroaniline in the environment. 4-Chloro-2-nitroaniline is a nitroaromatic compound that is widely used in the production of dyes, pigments, and pesticides. It is known to be toxic and potentially carcinogenic to humans and animals. The use of [13C6]-4-Chloro-2-nitroaniline as an internal standard can improve the accuracy and precision of analytical measurements, which is essential for the evaluation of human and environmental exposure to this hazardous compound. The chemical formula of [13C6]-4-Chloro-2-nitroaniline is C6H3ClN2O2. It has a molecular weight of 188.57 g/mol and a melting point of 148-152°C. The compound is soluble in organic solvents such as methanol, ethanol, and acetone, but insoluble in water. Its purity and isotopic enrichment level should be carefully assessed before use in analytical applications.