Acetophenone D5, a derivative of acetophenone, is a chemically significant compound renowned for its versatility in various industrial applications. With a molecular structure marked by a distinctive deuterium isotope substitution, it offers unique properties that make it indispensable in the realms of pharmaceuticals, fine chemicals synthesis, and research. Its stable isotopic composition and well-defined properties render it a valuable tool for tracer studies and as a precursor in the synthesis of labeled compounds, contributing to advancements in chemistry and science as a whole.
Let's Start the Conversation !
Chemical Name | Acetophenone D5 |
---|---|
CAT No. | CS-O-02954 |
CAS Registry# | 28077-64-7 |
Status | Available for Immediate Dispatch |
Category | Stable Isotope Reagent |
Mol. Wt. | 125.18 g/mol |
Mol. For. | C₈H₃D₅O |
Hazardous | This is a Hazardous Compound |
COA | View Sample COA |
MSDS | View Sample MSDS |
Controlled | No |
---|---|
Parent API | Acetophenone |
Isotopic Enrichment | NLT 99.0% D atom |
Smileys | CC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])=O |
Canonical Smiles | CC(=O)C1=CC=CC=C1 |
InchIKey | KWOLFJPFCHCOCG-VIQYUKPQSA-N |
Inchl | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3/i2D,3D,4D,5D,6D |
IUPAC | 1-(2,3,4,5,6-pentadeuteriophenyl)ethanone |
Hazardous | Yes |
This page contains information about Acetophenone D5, its usage, chemical properties and purchase details.