Amphotericin B EP Impurity B
| Chemical Name | Amphotericin B EP Impurity B |
|---|---|
| Alternate Names | Amphotericin B Impurities, Impurities of Amphotericin B |
| CAT No. | CS-O-13555 |
| CAS Registry# | 136135-57-4 |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 938.11 g/mol |
| Mol. For. | C₄₈H₇₅NO₁₇ |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Amphotericin B |
| Purity | 95% |
| Therapeutic | Anti-Fungals |
| Smileys | CO[C@]1(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](C2)O)O)O)O)O)O[C@](C[C@H](/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])[C@H](C(O)=O)[C@@H](O)C1 |
| Canonical Smiles | CC1C=CC=CC=CC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(CC(C(CCC(CC(CC(=O)OC(C(C1O)C)C)O)O)O)O)O)OC)O)C(=O)O)OC3C(C(C(C(O3)C)O)N)O |
| InchIKey | IJLVDQCUUOUTLI-TYVGYKFWSA-N |
| Inchl | InChI=1S/C48H75NO17/c1-28-18-16-14-12-10-8-6-7-9-11-13-15-17-19-35(65-47-45(59)42(49)44(58)31(4)64-47)25-39-41(46(60)61)38(55)27-48(62-5,66-39)26-34(52)23-37(54)36(53)21-20-32(50)22-33(51)24-40(56)63-30(3)29(2)43(28)57/h6-19,28-39,41-45,47,50-55,57-59H,20-27,49H2,1-5H3,(H,60,61)/b7-6+,10-8+,11-9+,14-12+,15-13+,18-16+,19-17+/t28-,29-,30-,31+,32+,33+,34-,35-,36+,37+,38-,39-,41+,42-,43+,44+,45-,47-,48+/m0/s1 |
| IUPAC | (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3,5,6,9,11,17,37-heptahydroxy-1-methoxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| Controlled | No |
| Shipping | Free for purchase above 200$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Amphotericin B EP Impurity B is a chemical substance that is commonly used in research and development laboratories for analytical purposes. It is a byproduct of the synthesis of Amphotericin B, a drug used for the treatment of fungal infections.
Amphotericin B EP Impurity B is a white to off-white powder that is soluble in polar solvents such as methanol and ethanol. It has a molecular weight of 924.05 g/mol and a melting point of 230-240°C.
Chemically, Amphotericin B EP Impurity B is a derivative of Amphotericin B, which is a polyene macrolide antibiotic that works by binding to ergosterol, a component of fungal cell membranes. This binding disrupts the fungal cell membrane, leading to the death of the fungus. Amphotericin B EP Impurity B is structurally similar to Amphotericin B, but contains an additional hydroxyl group.
In research settings, Amphotericin B EP Impurity B is used as a reference standard for the identification and quantification of Amphotericin B impurities. It is also used in the development and validation of analytical methods for the detection of Amphotericin B in pharmaceutical formulations.
Overall, Amphotericin B EP Impurity B is a valuable analytical tool that is used in the development and quality control of Amphotericin B formulations, as well as in research studies focused on the mechanisms of action of Amphotericin B and related compounds.
Get an Instant Quote
Related Compounds
Amphotericin B EP Impurity A | Amphotericin B Impurity E | Amphotericin B EP Impurity C | Amphotericin B (16s)dimethyl pentahydroxyhexyl Impurity |