Empagliflozin Enantiomer Impurity
| Product Name | Empagliflozin Enantiomer Impurity |
|---|---|
| Alternate Names | Empagliflozin Impurities, Impurities of Empagliflozin |
| CAT No. | CS-O-14885 |
| CAS No. | Not Available |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 450.91 g/mol |
| Mol. For. | C₂₃H₂₇ClO₇ |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Empagliflozin |
| Purity | 95% |
| Therapeutic | Anti-Diabetic |
| Smileys | O[C@@H]1[C@@H](C2=CC=C(Cl)C(CC3=CC=C(O[C@@H]4COCC4)C=C3)=C2)O[C@@H](CO)[C@H](O)[C@H]1O |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Empagliflozin is a medication used in the treatment of type 2 diabetes mellitus. It works by inhibiting the sodium-glucose cotransporter-2 (SGLT2) in the kidneys, which leads to increased glucose excretion in urine and reduced blood glucose levels. However, Empagliflozin Enantiomer Impurity is an impurity that can be present in Empagliflozin.
Empagliflozin Enantiomer Impurity is a chemical compound that has the same chemical formula as Empagliflozin but has a different molecular structure. It is a chiral compound, which means it exists in two mirror-image forms. Empagliflozin Enantiomer Impurity is the mirror image of Empagliflozin and is considered an impurity because it has no therapeutic effect and can potentially cause harm.
The usage of Empagliflozin Enantiomer Impurity is strictly regulated, and it is only allowed in very small amounts in Empagliflozin medication. The standard limit for Empagliflozin Enantiomer Impurity in Empagliflozin medication is 0.15%. If the level of Empagliflozin Enantiomer Impurity is higher than the standard limit, it can cause adverse effects such as allergic reactions, gastrointestinal disturbances, and liver damage.
In conclusion, Empagliflozin Enantiomer Impurity is an impurity that can be present in Empagliflozin medication. Its usage is regulated due to its potential harmful effects, and its presence in Empagliflozin medication must be kept at a minimum level.
Get an Instant Quote
Related Compounds
Empagliflozin impurity B | Empagliflozin S-Furanose | Empagliflozin impurity C | Empagliflozin Dichloro impurity | Empagliflozin Open Ring Impurity | Empagliflozin Methoxy impurity | Empagliflozin Intermediate-A | Empagliflozin Impurity 2 | Empagliflozin Impurity POE | Empagliflozin Impurity E | Empagliflozin impurity D | Empagliflozin Impurity 26 | Empagliflozin M464 | Empagliflozin Diol impurity (S-Isomer) | Methoxy Empagliflozin R-Furanose | Empagliflozin Impurity 52 | Empagliflozin M468 | Empagliflozin Nosyl impurity | Empagliflozin MonoAcetyl Impurity | Empagliflozin Methoxy Intermediate | Empagliflozin Methyl Acetate | Empagliflozin Sulfonate Impurity | Empagliflozin Bromo Impurity | Empagliflozin L- Glucono Diastereomer | Hydroxy empagliflozin | Empagliflozin alpha Isomer | Empagliflozin Impurity 40 | Empagliflozin Silyl Impurity | Empagliflozin impurity A | Empagliflozin Recemic mixture | Empagliflozin Impurity II | O-Destetrahydrofuran O-Pentaacetyl Empagliflozin | Empagliflozin Impurity 5 | Empagliflozin R-Furanose | Empagliflozin Impurity 50 | Empagliflozin Des bromomethoxy | Empagliflozin Impurity 62 | Empagliflozin Impurity 82 | Empagliflozin Dimer Impurity | Empagliflozin Acetyl impurity | Empagliflozin Iodo R-furan impurity | Empagliflozin Iodo impurity | Empagliflozin Nosyl ester hydroxy furan impurity | Empagliflozin Impurity 4 | Empagliflozin Destetrahydrofuran Impurity | Empagliflozin Enantiomer Impurity | DIMETHOXY EMPAGLIFLOZIN | Empagliflozin Sugar Dimer | Empagliflozin Impurity 46 |