Per-6-iodo-gamma-cyclodextrin
| Product Name | Per-6-iodo-gamma-cyclodextrin |
|---|---|
| CAT No. | CS-O-32902 |
| CAS No. | 168296-33-1 |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 2176.30 g/mol |
| Mol. For. | C48H72I8O32 |
| Hazardous | This is not a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Smileys | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CI)CI)CI)CI)CI)CI)CI)O)O)I |
| Canonical Smiles | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CI)CI)CI)CI)CI)CI)CI)O)O)I |
| InchIKey | IHISFVNFOGFWNA-HSEONFRVSA-N |
| Inchl | InChI=1S/C48H72I8O32/c49-1-9-33-17(57)25(65)41(73-9)82-34-10(2-50)75-43(27(67)19(34)59)84-36-12(4-52)77-45(29(69)21(36)61)86-38-14(6-54)79-47(31(71)23(38)63)88-40-16(8-56)80-48(32(72)24(40)64)87-39-15(7-55)78-46(30(70)22(39)62)85-37-13(5-53)76-44(28(68)20(37)60)83-35-11(3-51)74-42(81-33)26(66)18(35)58/h9-48,57-72H,1-8H2/t9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-/m1/s1 |
| IUPAC | (1S,3S,5S,6S,8S,10S,11S,13S,15S,16S,18S,20S,21S,23S,25S,26S,28S,30S,31S,33S,35S,36S,38S,40S,41R,42R,43R,44R,45R,46R,47R,48R,49R,50R,51R,52R,53R,54R,55R,56R)-5,10,15,20,25,30,35,40-octakis(iodomethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane-41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56-hexadecol |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Per-6-iodo-gamma-cyclodextrin is a chemical compound that is commonly used in the field of chemistry for various applications. It is a derivative of the gamma-cyclodextrin molecule, which is a cyclic oligosaccharide composed of six glucose units. The iodine atoms in the per-6-iodo-gamma-cyclodextrin molecule are important for its reactivity in chemical reactions.
One of the primary uses of per-6-iodo-gamma-cyclodextrin is as a molecular host for guest molecules in supramolecular chemistry. This is because the unique structure of the gamma-cyclodextrin molecule allows it to form inclusion complexes with various guest molecules, such as drugs, dyes, and fragrances. The iodine atoms in the per-6-iodo-gamma-cyclodextrin molecule also provide additional reactivity and specificity in the formation of these inclusion complexes.
Per-6-iodo-gamma-cyclodextrin is also used in analytical chemistry for the detection and analysis of certain compounds. This is because the inclusion complexes formed between per-6-iodo-gamma-cyclodextrin and guest molecules can be easily detected using various spectroscopic techniques.
In terms of its chemical properties, per-6-iodo-gamma-cyclodextrin is a water-soluble compound that is stable under normal conditions. It has a molecular weight of approximately 1564 g/mol and a melting point of around 300-320°C.
Overall, per-6-iodo-gamma-cyclodextrin is a valuable compound in the field of chemistry due to its unique structure and reactivity. Its ability to form inclusion complexes with various guest molecules makes it a useful tool in molecular recognition and analytical chemistry applications.
Get an Instant Quote
This page contains information about Per-6-iodo-gamma-cyclodextrin. You can buy Per-6-iodo-gamma-cyclodextrin from Clearsynth at best competitive price with assured price guarantee. Clearsynth offers best quality Per-6-iodo-gamma-cyclodextrin