4-(Methoxy-D3)benzaldehyde is a chemical compound characterized by the presence of a deuterium-labeled methoxy group (-OCH3) attached to the fourth carbon atom of the benzaldehyde ring. This isotopically labeled compound is often used in research and analytical chemistry to study reaction mechanisms and metabolic pathways due to its unique isotopic signature, which can provide valuable insights into chemical processes and molecular interactions.
Let's Start the Conversation !
Chemical Name | 4-(METHOXY-D3)BENZALDEHYDE |
---|---|
CAT No. | CS-O-42492 |
CAS Registry# | 342611-04-5 |
Status | Available for Immediate Dispatch |
Category | Stable Isotope Reagent |
Mol. Wt. | 139.17 g/mol |
Mol. For. | C₈H₅D₃O₂ |
Hazardous | This is a Hazardous Compound |
COA | View Sample COA |
MSDS | View Sample MSDS |
Controlled | No |
---|---|
Parent API | Benzene |
Isotopic Enrichment | NLT 99.0% D atom |
Canonical Smiles | COC1=CC=C(C=C1)C=O |
InchIKey | ZRSNZINYAWTAHE-FIBGUPNXSA-N |
Inchl | InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3/i1D3 |
IUPAC | 4-(trideuteriomethoxy)benzaldehyde |
Hazardous | Yes |
This page contains information about 4-(METHOXY-D3)BENZALDEHYDE, its usage, chemical properties and purchase details.