Acetylaniline D5 is a deuterium-labeled derivative of acetylaniline, a chemical compound known for its diverse applications in the field of organic chemistry and pharmaceutical research. With its unique isotopic composition, Acetylaniline D5 offers researchers a valuable tool for tracing and studying chemical reactions, metabolism, and various analytical techniques, enhancing our understanding of this versatile compound's behavior and potential in scientific investigations.
Let's Start the Conversation !
Chemical Name | Acetylaniline D5 |
---|---|
CAT No. | CS-T-47110 |
CAS Registry# | 15826-91-2 |
Status | Available for Immediate Dispatch |
Category | Deuterated Reagents |
Mol. Wt. | 140.19 g/mol |
Mol. For. | C₈H₄D₅NO |
Hazardous | This is a Hazardous Compound |
COA | View Sample COA |
MSDS | View Sample MSDS |
Controlled | No |
---|---|
Parent API | Aniline |
Isotopic Enrichment | Not less than 99.0 atom % D |
Smileys | CC(NC(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])=O |
Canonical Smiles | CC(=O)NC1=CC=CC=C1 |
InchIKey | FZERHIULMFGESH-VIQYUKPQSA-N |
Inchl | InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i2D,3D,4D,5D,6D |
IUPAC | N-(2,3,4,5,6-pentadeuteriophenyl)acetamide |
Hazardous | Yes |
This page contains information about Acetylaniline D5, its usage, chemical properties and purchase details.