Benzoic Acid D5, a compound known for its versatile applications, holds a significant place in various industries due to its unique properties. From its role as a preservative in the food and beverage industry to its use as a precursor in the synthesis of pharmaceuticals and fragrances, Benzoic Acid D5 stands out as a crucial chemical component. This compound, with its distinctive characteristics, plays a pivotal role in diverse applications, making it an indispensable element in several manufacturing processes.
Let's Start the Conversation !
Chemical Name | Benzoic Acid D5 |
---|---|
CAT No. | CS-T-48678 |
CAS Registry# | 1079-02-3 |
Status | Available for Immediate Dispatch |
Category | Stable Isotope Reagent, Deuterated Reagents |
Mol. Wt. | 127.15 g/mol |
Mol. For. | C₇HD₅O₂ |
Hazardous | This is a Hazardous Compound |
COA | View Sample COA |
MSDS | View Sample MSDS |
Controlled | No |
---|---|
Parent API | Benzene |
Purity | Not less than 98% |
Isotopic Enrichment | NLT 99.0% D atom |
Smileys | O=C(O)C1=C([2H])C([2H])=C([2H])C([2H])=C1[2H] |
Canonical Smiles | C1=CC=C(C=C1)C(=O)O |
InchIKey | WPYMKLBDIGXBTP-RALIUCGRSA-N |
Inchl | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1D,2D,3D,4D,5D |
IUPAC | 2,3,4,5,6-pentadeuteriobenzoic acid |
Hazardous | Yes |
This page contains information about Benzoic Acid D5, its usage, chemical properties and purchase details.