Amphotericin B Methyl Ester D3
| Product Name | Amphotericin B Methyl Ester D3 |
|---|---|
| Alternate Names | Amphotericin B Stable Isotopes, Stable Isotopes of Amphotericin B |
| CAT No. | CS-O-10085 |
| CAS No. | Not Available |
| Category | Stable Isotopes |
| Stock | IN-Stock |
| Mol. Wt. | 941.12 g/mol |
| Mol. For. | C₄₈H₇₂D₃NO₁₇ |
| Hazardous | This is not a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Amphotericin B |
| Purity | 95.83 |
| Therapeutic | Anti-Fungals |
| Smileys | O=C([C@H]1[C@@](C[C@H](/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](C2)O)O)O)O)O)C[C@@H]1O)OC([2H])([2H])[2H] |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Amphotericin B Methyl Ester D3 is a potent antifungal drug that is commonly used to treat severe fungal infections. It is a derivative of Amphotericin B, which is a polyene macrolide antibiotic. Amphotericin B Methyl Ester D3 is a semi-synthetic formulation that is more water-soluble than its parent compound, making it easier to administer.
The drug works by binding to ergosterol, a component of fungal cell membranes, which disrupts their structure and function, leading to cell death. Amphotericin B Methyl Ester D3 is effective against a wide range of fungal infections, including aspergillosis, candidiasis, and cryptococcosis.
Amphotericin B Methyl Ester D3 is administered intravenously, usually in a hospital setting, due to its potential side effects. These can include fever, chills, nausea, vomiting, and kidney damage. Patients receiving the drug are typically monitored closely for any adverse reactions.
Chemically, Amphotericin B Methyl Ester D3 is a mixture of different analogs, with the D3 form being one of the major components. The compound has a molecular formula of C47H73NO13 and a molecular weight of 867.11 g/mol. Its structure consists of a polyene macrolide backbone, with a methyl ester group at one end.
In conclusion, Amphotericin B Methyl Ester D3 is a powerful antifungal drug that is used to treat serious fungal infections. While it can have side effects, its effectiveness in treating such infections makes it an important tool in the fight against fungal diseases.
Get an Instant Quote
Related Compounds
Amphotericin B 13C6 | Amphotericin B-13C6 Methyl Ester | Amphotericin B Methyl Ester 13CD3 |